C23H24N4O4S — CID 46794162
[1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl] 2-quinoxalin-2-ylsulfanylacetate (PubChem CID 46794162) has the molecular formula C23H24N4O4S and a molecular weight of 452.54 g/mol. Its IUPAC name is [1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl] 2-quinoxalin-2-ylsulfanylacetate.
| Compound Name | [1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl] 2-quinoxalin-2-ylsulfanylacetate |
|---|---|
| PubChem CID | 46794162 |
| Molecular Formula | C23H24N4O4S |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | [1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl] 2-quinoxalin-2-ylsulfanylacetate |
| SMILES | CC(OC(=O)CSc1cnc2ccccc2n1)C(=O)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C23H24N4O4S/c1-16(23(29)25-17-6-8-18(9-7-17)27-10-12-30-13-11-27)31-22(28)15-32-21-14-24-19-4-2-3-5-20(19)26-21/h2-9,14,16H,10-13,15H2,1H3,(H,25,29) |
| InChIKey | ZBGIQXHZDAGSNV-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|