C24H18FN3O3S — CID 55322904
[2-(4-fluoroanilino)-2-oxo-1-phenylethyl] 2-quinoxalin-2-ylsulfanylacetate (PubChem CID 55322904) has the molecular formula C24H18FN3O3S and a molecular weight of 447.49 g/mol. Its IUPAC name is [2-(4-fluoroanilino)-2-oxo-1-phenylethyl] 2-quinoxalin-2-ylsulfanylacetate.
| Compound Name | [2-(4-fluoroanilino)-2-oxo-1-phenylethyl] 2-quinoxalin-2-ylsulfanylacetate |
|---|---|
| PubChem CID | 55322904 |
| Molecular Formula | C24H18FN3O3S |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | [2-(4-fluoroanilino)-2-oxo-1-phenylethyl] 2-quinoxalin-2-ylsulfanylacetate |
| SMILES | O=C(CSc1cnc2ccccc2n1)OC(C(=O)Nc1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H18FN3O3S/c25-17-10-12-18(13-11-17)27-24(30)23(16-6-2-1-3-7-16)31-22(29)15-32-21-14-26-19-8-4-5-9-20(19)28-21/h1-14,23H,15H2,(H,27,30) |
| InChIKey | HKNOLGHDFBCHAD-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |