C19H14F3N3O3S — CID 33485557
[(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2-quinoxalin-2-ylsulfanylacetate (PubChem CID 33485557) has the molecular formula C19H14F3N3O3S and a molecular weight of 421.40 g/mol. Its IUPAC name is [(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2-quinoxalin-2-ylsulfanylacetate.
| Compound Name | [(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2-quinoxalin-2-ylsulfanylacetate |
|---|---|
| PubChem CID | 33485557 |
| Molecular Formula | C19H14F3N3O3S |
| Molecular Weight | 421.40 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | [(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2-quinoxalin-2-ylsulfanylacetate |
| SMILES | C[C@@H](OC(=O)CSc1cnc2ccccc2n1)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C19H14F3N3O3S/c1-10(19(27)25-14-7-6-11(20)17(21)18(14)22)28-16(26)9-29-15-8-23-12-4-2-3-5-13(12)24-15/h2-8,10H,9H2,1H3,(H,25,27)/t10-/m1/s1 |
| InChIKey | XHHTWRSGUZVUID-SNVBAGLBSA-N |
| XLogP | 3.71 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|