C21H19NO5S — CID 46818335
[2-(N-(2-ethoxy-2-oxoethyl)anilino)-2-oxoethyl] 1-benzothiophene-2-carboxylate (PubChem CID 46818335) has the molecular formula C21H19NO5S and a molecular weight of 397.45 g/mol. Its IUPAC name is [2-(N-(2-ethoxy-2-oxoethyl)anilino)-2-oxoethyl] 1-benzothiophene-2-carboxylate.
| Compound Name | [2-(N-(2-ethoxy-2-oxoethyl)anilino)-2-oxoethyl] 1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 46818335 |
| Molecular Formula | C21H19NO5S |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | [2-(N-(2-ethoxy-2-oxoethyl)anilino)-2-oxoethyl] 1-benzothiophene-2-carboxylate |
| SMILES | CCOC(=O)CN(C(=O)COC(=O)c1cc2ccccc2s1)c1ccccc1 |
| InChI | InChI=1S/C21H19NO5S/c1-2-26-20(24)13-22(16-9-4-3-5-10-16)19(23)14-27-21(25)18-12-15-8-6-7-11-17(15)28-18/h3-12H,2,13-14H2,1H3 |
| InChIKey | GTNOKWGNYJQQSG-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |