C21H20N2O5S — CID 46697210
[2-(N-(2-ethoxy-2-oxoethyl)anilino)-2-oxoethyl] 3-pyrrol-1-ylthiophene-2-carboxylate (PubChem CID 46697210) has the molecular formula C21H20N2O5S and a molecular weight of 412.47 g/mol. Its IUPAC name is [2-(N-(2-ethoxy-2-oxoethyl)anilino)-2-oxoethyl] 3-pyrrol-1-ylthiophene-2-carboxylate.
| Compound Name | [2-(N-(2-ethoxy-2-oxoethyl)anilino)-2-oxoethyl] 3-pyrrol-1-ylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 46697210 |
| Molecular Formula | C21H20N2O5S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | [2-(N-(2-ethoxy-2-oxoethyl)anilino)-2-oxoethyl] 3-pyrrol-1-ylthiophene-2-carboxylate |
| SMILES | CCOC(=O)CN(C(=O)COC(=O)c1sccc1-n1cccc1)c1ccccc1 |
| InChI | InChI=1S/C21H20N2O5S/c1-2-27-19(25)14-23(16-8-4-3-5-9-16)18(24)15-28-21(26)20-17(10-13-29-20)22-11-6-7-12-22/h3-13H,2,14-15H2,1H3 |
| InChIKey | FSZUJMBRGXBBRQ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |