C19H29NO4 — CID 46831602
2,2,3,4,4,5,5-heptadeuterio-1-[(1R,2R)-2-[2-(3-hydroxy-4-methoxyphenyl)ethoxy]cyclohexyl]pyrrolidin-3-ol (PubChem CID 46831602) has the molecular formula C19H29NO4 and a molecular weight of 342.49 g/mol. Its IUPAC name is 2,2,3,4,4,5,5-heptadeuterio-1-[(1R,2R)-2-[2-(3-hydroxy-4-methoxyphenyl)ethoxy]cyclohexyl]pyrrolidin-3-ol.
| Compound Name | 2,2,3,4,4,5,5-heptadeuterio-1-[(1R,2R)-2-[2-(3-hydroxy-4-methoxyphenyl)ethoxy]cyclohexyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 46831602 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.25 |
| IUPAC Name | 2,2,3,4,4,5,5-heptadeuterio-1-[(1R,2R)-2-[2-(3-hydroxy-4-methoxyphenyl)ethoxy]cyclohexyl]pyrrolidin-3-ol |
| SMILES | [2H]C1([2H])N([C@@H]2CCCC[C@H]2OCCc2ccc(OC)c(O)c2)C([2H])([2H])C([2H])(O)C1([2H])[2H] |
| InChI | InChI=1S/C19H29NO4/c1-23-19-7-6-14(12-17(19)22)9-11-24-18-5-3-2-4-16(18)20-10-8-15(21)13-20/h6-7,12,15-16,18,21-22H,2-5,8-11,13H2,1H3/t15?,16-,18-/m1/s1/i8D2,10D2,13D2,15D |
| InChIKey | QQQCKDZSXFRYBN-JZMGPCHRSA-N |
| XLogP | 2.34 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |