C22H28O6S — CID 87415266
[(1S,2R)-2-[2-(3-hydroxy-4-methoxyphenyl)ethoxy]cyclohexyl] 4-methylbenzenesulfonate (PubChem CID 87415266) has the molecular formula C22H28O6S and a molecular weight of 420.53 g/mol. Its IUPAC name is [(1S,2R)-2-[2-(3-hydroxy-4-methoxyphenyl)ethoxy]cyclohexyl] 4-methylbenzenesulfonate.
| Compound Name | [(1S,2R)-2-[2-(3-hydroxy-4-methoxyphenyl)ethoxy]cyclohexyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87415266 |
| Molecular Formula | C22H28O6S |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | [(1S,2R)-2-[2-(3-hydroxy-4-methoxyphenyl)ethoxy]cyclohexyl] 4-methylbenzenesulfonate |
| SMILES | COc1ccc(CCO[C@@H]2CCCC[C@@H]2OS(=O)(=O)c2ccc(C)cc2)cc1O |
| InChI | InChI=1S/C22H28O6S/c1-16-7-10-18(11-8-16)29(24,25)28-22-6-4-3-5-21(22)27-14-13-17-9-12-20(26-2)19(23)15-17/h7-12,15,21-23H,3-6,13-14H2,1-2H3/t21-,22+/m1/s1 |
| InChIKey | PADCVINAVYYSAL-YADHBBJMSA-N |
| XLogP | 3.99 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|