C28H26N4O3 — CID 46833915
N-(2-aminophenyl)-6-[3-(1,3-benzoxazol-2-yl)-4-oxoquinolin-1-yl]hexanamide (PubChem CID 46833915) has the molecular formula C28H26N4O3 and a molecular weight of 466.54 g/mol. Its IUPAC name is N-(2-aminophenyl)-6-[3-(1,3-benzoxazol-2-yl)-4-oxoquinolin-1-yl]hexanamide.
| Compound Name | N-(2-aminophenyl)-6-[3-(1,3-benzoxazol-2-yl)-4-oxoquinolin-1-yl]hexanamide |
|---|---|
| PubChem CID | 46833915 |
| Molecular Formula | C28H26N4O3 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | N-(2-aminophenyl)-6-[3-(1,3-benzoxazol-2-yl)-4-oxoquinolin-1-yl]hexanamide |
| SMILES | Nc1ccccc1NC(=O)CCCCCn1cc(-c2nc3ccccc3o2)c(=O)c2ccccc21 |
| InChI | InChI=1S/C28H26N4O3/c29-21-11-4-5-12-22(21)30-26(33)16-2-1-9-17-32-18-20(27(34)19-10-3-7-14-24(19)32)28-31-23-13-6-8-15-25(23)35-28/h3-8,10-15,18H,1-2,9,16-17,29H2,(H,30,33) |
| InChIKey | JMQSPYLWMFJOEP-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 103.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|