C12H9N3S — CID 46836976
13-thia-4,5,7-triazatetracyclo[7.7.0.02,6.012,16]hexadeca-1,3,6,8,12(16),14-hexaene (PubChem CID 46836976) has the molecular formula C12H9N3S and a molecular weight of 227.29 g/mol. Its IUPAC name is 13-thia-4,5,7-triazatetracyclo[7.7.0.02,6.012,16]hexadeca-1,3,6,8,12(16),14-hexaene.
| Compound Name | 13-thia-4,5,7-triazatetracyclo[7.7.0.02,6.012,16]hexadeca-1,3,6,8,12(16),14-hexaene |
|---|---|
| PubChem CID | 46836976 |
| Molecular Formula | C12H9N3S |
| Molecular Weight | 227.29 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | 13-thia-4,5,7-triazatetracyclo[7.7.0.02,6.012,16]hexadeca-1,3,6,8,12(16),14-hexaene |
| SMILES | c1cc2c(s1)CCc1cnc3[nH]ncc3c1-2 |
| InChI | InChI=1S/C12H9N3S/c1-2-10-8(3-4-16-10)11-7(1)5-13-12-9(11)6-14-15-12/h3-6H,1-2H2,(H,13,14,15) |
| InChIKey | MRMFVGYKWFGQII-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.29 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |