C20H23NO7 — CID 46838220
N-methyl-3-[4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]benzamide (PubChem CID 46838220) has the molecular formula C20H23NO7 and a molecular weight of 389.40 g/mol. Its IUPAC name is N-methyl-3-[4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]benzamide.
| Compound Name | N-methyl-3-[4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]benzamide |
|---|---|
| PubChem CID | 46838220 |
| Molecular Formula | C20H23NO7 |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | N-methyl-3-[4-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]benzamide |
| SMILES | CNC(=O)c1cccc(-c2ccc(O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)cc2)c1 |
| InChI | InChI=1S/C20H23NO7/c1-21-19(26)13-4-2-3-12(9-13)11-5-7-14(8-6-11)27-20-18(25)17(24)16(23)15(10-22)28-20/h2-9,15-18,20,22-25H,10H2,1H3,(H,21,26)/t15-,16-,17+,18+,20+/m1/s1 |
| InChIKey | VFTSDWMJWKJCAA-JGLNRKDHSA-N |
| XLogP | -0.11 |
| TPSA | 128.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |