C25H34BrNO5Si — CID 46838796
5-(bromomethyl)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(3,4-dimethoxyphenyl)methyl]-6-methoxy-3H-isoindol-1-one (PubChem CID 46838796) has the molecular formula C25H34BrNO5Si and a molecular weight of 536.54 g/mol. Its IUPAC name is 5-(bromomethyl)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(3,4-dimethoxyphenyl)methyl]-6-methoxy-3H-isoindol-1-one.
| Compound Name | 5-(bromomethyl)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(3,4-dimethoxyphenyl)methyl]-6-methoxy-3H-isoindol-1-one |
|---|---|
| PubChem CID | 46838796 |
| Molecular Formula | C25H34BrNO5Si |
| Molecular Weight | 536.54 g/mol |
| Exact Mass | 535.14 |
| IUPAC Name | 5-(bromomethyl)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(3,4-dimethoxyphenyl)methyl]-6-methoxy-3H-isoindol-1-one |
| SMILES | COc1ccc(CN2Cc3c(cc(OC)c(CBr)c3O[Si](C)(C)C(C)(C)C)C2=O)cc1OC |
| InChI | InChI=1S/C25H34BrNO5Si/c1-25(2,3)33(7,8)32-23-18(13-26)21(30-5)12-17-19(23)15-27(24(17)28)14-16-9-10-20(29-4)22(11-16)31-6/h9-12H,13-15H2,1-8H3 |
| InChIKey | GGYHQANSCUDQGM-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.54 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|