C22H26N2O — CID 46843085
10-(piperidin-1-ylmethyl)-1,2,3,4,6,11-hexahydroindeno[1,2-c]isoquinolin-5-one (PubChem CID 46843085) has the molecular formula C22H26N2O and a molecular weight of 334.46 g/mol. Its IUPAC name is 10-(piperidin-1-ylmethyl)-1,2,3,4,6,11-hexahydroindeno[1,2-c]isoquinolin-5-one.
| Compound Name | 10-(piperidin-1-ylmethyl)-1,2,3,4,6,11-hexahydroindeno[1,2-c]isoquinolin-5-one |
|---|---|
| PubChem CID | 46843085 |
| Molecular Formula | C22H26N2O |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 10-(piperidin-1-ylmethyl)-1,2,3,4,6,11-hexahydroindeno[1,2-c]isoquinolin-5-one |
| SMILES | O=c1[nH]c2c(c3c1CCCC3)Cc1c(CN3CCCCC3)cccc1-2 |
| InChI | InChI=1S/C22H26N2O/c25-22-18-9-3-2-8-16(18)20-13-19-15(14-24-11-4-1-5-12-24)7-6-10-17(19)21(20)23-22/h6-7,10H,1-5,8-9,11-14H2,(H,23,25) |
| InChIKey | HLWLCZOBOMCRBP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |