C35H35BF2N2O2 — CID 46844212
5-[2,5-bis(phenylmethoxy)phenyl]-11-ethyl-2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 46844212) has the molecular formula C35H35BF2N2O2 and a molecular weight of 564.49 g/mol. Its IUPAC name is 5-[2,5-bis(phenylmethoxy)phenyl]-11-ethyl-2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 5-[2,5-bis(phenylmethoxy)phenyl]-11-ethyl-2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 46844212 |
| Molecular Formula | C35H35BF2N2O2 |
| Molecular Weight | 564.49 g/mol |
| Exact Mass | 564.28 |
| IUPAC Name | 5-[2,5-bis(phenylmethoxy)phenyl]-11-ethyl-2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | CCC1=C(C)C2=Cc3c(C)c(-c4cc(OCc5ccccc5)ccc4OCc4ccccc4)c(C)n3[B-](F)(F)[N+]2=C1C |
| InChI | InChI=1S/C35H35BF2N2O2/c1-6-30-23(2)32-20-33-24(3)35(26(5)40(33)36(37,38)39(32)25(30)4)31-19-29(41-21-27-13-9-7-10-14-27)17-18-34(31)42-22-28-15-11-8-12-16-28/h7-20H,6,21-22H2,1-5H3 |
| InChIKey | ZJYCUWNCPRIQQO-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 26.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.49 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|