C34H63N3O2 — CID 46845956
(3S,5R,6R,10R,13R)-6-[3-(4-aminobutylamino)propylamino]-10,13-dimethyl-17-(6-methylheptan-2-yl)-1,2,3,4,6,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,5-diol (PubChem CID 46845956) has the molecular formula C34H63N3O2 and a molecular weight of 545.90 g/mol. Its IUPAC name is (3S,5R,6R,10R,13R)-6-[3-(4-aminobutylamino)propylamino]-10,13-dimethyl-17-(6-methylheptan-2-yl)-1,2,3,4,6,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,5-diol.
| Compound Name | (3S,5R,6R,10R,13R)-6-[3-(4-aminobutylamino)propylamino]-10,13-dimethyl-17-(6-methylheptan-2-yl)-1,2,3,4,6,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,5-diol |
|---|---|
| PubChem CID | 46845956 |
| Molecular Formula | C34H63N3O2 |
| Molecular Weight | 545.90 g/mol |
| Exact Mass | 545.49 |
| IUPAC Name | (3S,5R,6R,10R,13R)-6-[3-(4-aminobutylamino)propylamino]-10,13-dimethyl-17-(6-methylheptan-2-yl)-1,2,3,4,6,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,5-diol |
| SMILES | CC(C)CCCC(C)C1CCC2C3=C[C@@H](NCCCNCCCCN)[C@@]4(O)C[C@@H](O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C34H63N3O2/c1-24(2)10-8-11-25(3)28-12-13-29-27-22-31(37-21-9-20-36-19-7-6-18-35)34(39)23-26(38)14-17-33(34,5)30(27)15-16-32(28,29)4/h22,24-26,28-31,36-39H,6-21,23,35H2,1-5H3/t25?,26-,28?,29?,30?,31+,32+,33+,34-/m0/s1 |
| InChIKey | BLYVUYZBUKXNDE-XWRCICNZSA-N |
| XLogP | 5.79 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.90 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|