C28H29N3O5S — CID 4684916
ethyl 2-[[2-[2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enoyl]oxyacetyl]amino]-5-phenylthiophene-3-carboxylate (PubChem CID 4684916) has the molecular formula C28H29N3O5S and a molecular weight of 519.62 g/mol. Its IUPAC name is ethyl 2-[[2-[2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enoyl]oxyacetyl]amino]-5-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enoyl]oxyacetyl]amino]-5-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 4684916 |
| Molecular Formula | C28H29N3O5S |
| Molecular Weight | 519.62 g/mol |
| Exact Mass | 519.18 |
| IUPAC Name | ethyl 2-[[2-[2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)prop-2-enoyl]oxyacetyl]amino]-5-phenylthiophene-3-carboxylate |
| SMILES | CCCn1c(C)cc(C=C(C#N)C(=O)OCC(=O)Nc2sc(-c3ccccc3)cc2C(=O)OCC)c1C |
| InChI | InChI=1S/C28H29N3O5S/c1-5-12-31-18(3)13-21(19(31)4)14-22(16-29)27(33)36-17-25(32)30-26-23(28(34)35-6-2)15-24(37-26)20-10-8-7-9-11-20/h7-11,13-15H,5-6,12,17H2,1-4H3,(H,30,32) |
| InChIKey | YNLZHKHISFUYLP-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 110.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.62 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|