C20H28N4O3SSi — CID 46853844
methyl 2-[(3R)-3-methyl-4-[(4-trimethylsilylphenyl)carbamoyl]piperazin-1-yl]-1,3-thiazole-4-carboxylate (PubChem CID 46853844) has the molecular formula C20H28N4O3SSi and a molecular weight of 432.62 g/mol. Its IUPAC name is methyl 2-[(3R)-3-methyl-4-[(4-trimethylsilylphenyl)carbamoyl]piperazin-1-yl]-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-[(3R)-3-methyl-4-[(4-trimethylsilylphenyl)carbamoyl]piperazin-1-yl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 46853844 |
| Molecular Formula | C20H28N4O3SSi |
| Molecular Weight | 432.62 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | methyl 2-[(3R)-3-methyl-4-[(4-trimethylsilylphenyl)carbamoyl]piperazin-1-yl]-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1csc(N2CCN(C(=O)Nc3ccc([Si](C)(C)C)cc3)[C@H](C)C2)n1 |
| InChI | InChI=1S/C20H28N4O3SSi/c1-14-12-23(20-22-17(13-28-20)18(25)27-2)10-11-24(14)19(26)21-15-6-8-16(9-7-15)29(3,4)5/h6-9,13-14H,10-12H2,1-5H3,(H,21,26)/t14-/m1/s1 |
| InChIKey | OGCMRZLRQPPSQM-CQSZACIVSA-N |
| XLogP | 3.22 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.62 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|