C21H31N5O2SSi — CID 154374966
N,N-dimethyl-2-[(3R)-3-methyl-4-[(4-trimethylsilylphenyl)carbamoyl]piperazin-1-yl]-1,3-thiazole-5-carboxamide (PubChem CID 154374966) has the molecular formula C21H31N5O2SSi and a molecular weight of 445.67 g/mol. Its IUPAC name is N,N-dimethyl-2-[(3R)-3-methyl-4-[(4-trimethylsilylphenyl)carbamoyl]piperazin-1-yl]-1,3-thiazole-5-carboxamide.
| Compound Name | N,N-dimethyl-2-[(3R)-3-methyl-4-[(4-trimethylsilylphenyl)carbamoyl]piperazin-1-yl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 154374966 |
| Molecular Formula | C21H31N5O2SSi |
| Molecular Weight | 445.67 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | N,N-dimethyl-2-[(3R)-3-methyl-4-[(4-trimethylsilylphenyl)carbamoyl]piperazin-1-yl]-1,3-thiazole-5-carboxamide |
| SMILES | C[C@@H]1CN(c2ncc(C(=O)N(C)C)s2)CCN1C(=O)Nc1ccc([Si](C)(C)C)cc1 |
| InChI | InChI=1S/C21H31N5O2SSi/c1-15-14-25(21-22-13-18(29-21)19(27)24(2)3)11-12-26(15)20(28)23-16-7-9-17(10-8-16)30(4,5)6/h7-10,13,15H,11-12,14H2,1-6H3,(H,23,28)/t15-/m1/s1 |
| InChIKey | NFWUHTWOLYEXAD-OAHLLOKOSA-N |
| XLogP | 3.13 |
| TPSA | 68.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.67 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|