C15H22N2O2Si — CID 46854015
(1S,2S,5R,8S)-8-[(2-methoxyphenyl)-dimethylsilyl]-6,7-diazabicyclo[3.2.1]oct-6-en-2-ol (PubChem CID 46854015) has the molecular formula C15H22N2O2Si and a molecular weight of 290.44 g/mol. Its IUPAC name is (1S,2S,5R,8S)-8-[(2-methoxyphenyl)-dimethylsilyl]-6,7-diazabicyclo[3.2.1]oct-6-en-2-ol.
| Compound Name | (1S,2S,5R,8S)-8-[(2-methoxyphenyl)-dimethylsilyl]-6,7-diazabicyclo[3.2.1]oct-6-en-2-ol |
|---|---|
| PubChem CID | 46854015 |
| Molecular Formula | C15H22N2O2Si |
| Molecular Weight | 290.44 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | (1S,2S,5R,8S)-8-[(2-methoxyphenyl)-dimethylsilyl]-6,7-diazabicyclo[3.2.1]oct-6-en-2-ol |
| SMILES | COc1ccccc1[Si](C)(C)[C@@H]1[C@H]2N=N[C@@H]1CC[C@@H]2O |
| InChI | InChI=1S/C15H22N2O2Si/c1-19-12-6-4-5-7-13(12)20(2,3)15-10-8-9-11(18)14(15)17-16-10/h4-7,10-11,14-15,18H,8-9H2,1-3H3/t10-,11+,14+,15+/m1/s1 |
| InChIKey | QGUPZSPUTWSVPF-PKIAMQTDSA-N |
| XLogP | 2.34 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.44 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|