C18H22N4O5S — CID 46854168
5-[[(3aS,4S,6S,6aS)-6-methylspiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,1'-cyclopentane]-4-yl]methylsulfonyl]-1-phenyltetrazole (PubChem CID 46854168) has the molecular formula C18H22N4O5S and a molecular weight of 406.46 g/mol. Its IUPAC name is 5-[[(3aS,4S,6S,6aS)-6-methylspiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,1'-cyclopentane]-4-yl]methylsulfonyl]-1-phenyltetrazole.
| Compound Name | 5-[[(3aS,4S,6S,6aS)-6-methylspiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,1'-cyclopentane]-4-yl]methylsulfonyl]-1-phenyltetrazole |
|---|---|
| PubChem CID | 46854168 |
| Molecular Formula | C18H22N4O5S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 5-[[(3aS,4S,6S,6aS)-6-methylspiro[3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-2,1'-cyclopentane]-4-yl]methylsulfonyl]-1-phenyltetrazole |
| SMILES | C[C@@H]1O[C@H](CS(=O)(=O)c2nnnn2-c2ccccc2)[C@H]2OC3(CCCC3)O[C@H]21 |
| InChI | InChI=1S/C18H22N4O5S/c1-12-15-16(27-18(26-15)9-5-6-10-18)14(25-12)11-28(23,24)17-19-20-21-22(17)13-7-3-2-4-8-13/h2-4,7-8,12,14-16H,5-6,9-11H2,1H3/t12-,14+,15-,16+/m0/s1 |
| InChIKey | XNJBMGMLAJQIPG-DRPJVOAASA-N |
| XLogP | 1.28 |
| TPSA | 105.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |