C15H25NO4 — CID 46854959
tert-butyl (2S)-2-[(1S)-1,6-dihydroxycyclohex-3-en-1-yl]pyrrolidine-1-carboxylate (PubChem CID 46854959) has the molecular formula C15H25NO4 and a molecular weight of 283.37 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(1S)-1,6-dihydroxycyclohex-3-en-1-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(1S)-1,6-dihydroxycyclohex-3-en-1-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 46854959 |
| Molecular Formula | C15H25NO4 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | tert-butyl (2S)-2-[(1S)-1,6-dihydroxycyclohex-3-en-1-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1[C@@]1(O)CC=CCC1O |
| InChI | InChI=1S/C15H25NO4/c1-14(2,3)20-13(18)16-10-6-7-11(16)15(19)9-5-4-8-12(15)17/h4-5,11-12,17,19H,6-10H2,1-3H3/t11-,12?,15-/m0/s1 |
| InChIKey | PCPSEPDQNFNNPW-BQELKBSMSA-N |
| XLogP | 1.83 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|