C26H36O2 — CID 46863366
ethyl (E)-3-[(1R,3R,3aR,4S,5S,7aR)-4-ethyl-1,3,7-trimethyl-5-phenyl-1,2,3,3a,5,7a-hexahydroinden-4-yl]-2-methylprop-2-enoate (PubChem CID 46863366) has the molecular formula C26H36O2 and a molecular weight of 380.57 g/mol. Its IUPAC name is ethyl (E)-3-[(1R,3R,3aR,4S,5S,7aR)-4-ethyl-1,3,7-trimethyl-5-phenyl-1,2,3,3a,5,7a-hexahydroinden-4-yl]-2-methylprop-2-enoate.
| Compound Name | ethyl (E)-3-[(1R,3R,3aR,4S,5S,7aR)-4-ethyl-1,3,7-trimethyl-5-phenyl-1,2,3,3a,5,7a-hexahydroinden-4-yl]-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 46863366 |
| Molecular Formula | C26H36O2 |
| Molecular Weight | 380.57 g/mol |
| Exact Mass | 380.27 |
| IUPAC Name | ethyl (E)-3-[(1R,3R,3aR,4S,5S,7aR)-4-ethyl-1,3,7-trimethyl-5-phenyl-1,2,3,3a,5,7a-hexahydroinden-4-yl]-2-methylprop-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/[C@]1(CC)[C@H]2[C@H](C(C)=C[C@H]1c1ccccc1)[C@H](C)C[C@H]2C |
| InChI | InChI=1S/C26H36O2/c1-7-26(16-20(6)25(27)28-8-2)22(21-12-10-9-11-13-21)15-18(4)23-17(3)14-19(5)24(23)26/h9-13,15-17,19,22-24H,7-8,14H2,1-6H3/b20-16+/t17-,19-,22+,23+,24-,26+/m1/s1 |
| InChIKey | GCCCTNMSEOAYCB-KBPXACQHSA-N |
| XLogP | 6.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.57 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|