C23H25N3O2S — CID 46863630
2-[[2-(1-adamantylimino)-3-methyl-1,3-thiazol-4-yl]methyl]isoindole-1,3-dione (PubChem CID 46863630) has the molecular formula C23H25N3O2S and a molecular weight of 407.54 g/mol. Its IUPAC name is 2-[[2-(1-adamantylimino)-3-methyl-1,3-thiazol-4-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[2-(1-adamantylimino)-3-methyl-1,3-thiazol-4-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 46863630 |
| Molecular Formula | C23H25N3O2S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 2-[[2-(1-adamantylimino)-3-methyl-1,3-thiazol-4-yl]methyl]isoindole-1,3-dione |
| SMILES | Cn1c(CN2C(=O)c3ccccc3C2=O)cs/c1=N\C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H25N3O2S/c1-25-17(12-26-20(27)18-4-2-3-5-19(18)21(26)28)13-29-22(25)24-23-9-14-6-15(10-23)8-16(7-14)11-23/h2-5,13-16H,6-12H2,1H3/b24-22- |
| InChIKey | RPFVZVHHFMVASN-GYHWCHFESA-N |
| XLogP | 3.75 |
| TPSA | 54.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|