C20H22BrNO2 — CID 98613652
2-[2-[(5S,7S)-3-bromo-1-adamantyl]ethyl]isoindole-1,3-dione (PubChem CID 98613652) has the molecular formula C20H22BrNO2 and a molecular weight of 388.31 g/mol. Its IUPAC name is 2-[2-[(5S,7S)-3-bromo-1-adamantyl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[(5S,7S)-3-bromo-1-adamantyl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 98613652 |
| Molecular Formula | C20H22BrNO2 |
| Molecular Weight | 388.31 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | 2-[2-[(5S,7S)-3-bromo-1-adamantyl]ethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCC12C[C@@H]3C[C@H](CC(Br)(C3)C1)C2 |
| InChI | InChI=1S/C20H22BrNO2/c21-20-10-13-7-14(11-20)9-19(8-13,12-20)5-6-22-17(23)15-3-1-2-4-16(15)18(22)24/h1-4,13-14H,5-12H2/t13-,14-,19?,20?/m0/s1 |
| InChIKey | PWFGNOOUZSWGGV-NILVNCKXSA-N |
| XLogP | 4.41 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.31 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|