C20H17BrFNO3 — CID 46865848
ethyl 3-(4-bromo-6-fluoro-3-phenylisoquinolin-1-yl)-2-hydroxypropanoate (PubChem CID 46865848) has the molecular formula C20H17BrFNO3 and a molecular weight of 418.26 g/mol. Its IUPAC name is ethyl 3-(4-bromo-6-fluoro-3-phenylisoquinolin-1-yl)-2-hydroxypropanoate.
| Compound Name | ethyl 3-(4-bromo-6-fluoro-3-phenylisoquinolin-1-yl)-2-hydroxypropanoate |
|---|---|
| PubChem CID | 46865848 |
| Molecular Formula | C20H17BrFNO3 |
| Molecular Weight | 418.26 g/mol |
| Exact Mass | 417.04 |
| IUPAC Name | ethyl 3-(4-bromo-6-fluoro-3-phenylisoquinolin-1-yl)-2-hydroxypropanoate |
| SMILES | CCOC(=O)C(O)Cc1nc(-c2ccccc2)c(Br)c2cc(F)ccc12 |
| InChI | InChI=1S/C20H17BrFNO3/c1-2-26-20(25)17(24)11-16-14-9-8-13(22)10-15(14)18(21)19(23-16)12-6-4-3-5-7-12/h3-10,17,24H,2,11H2,1H3 |
| InChIKey | LZVPJWWKSRLJST-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.26 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |