C26H17BrFIN2O2 — CID 135060193
ethyl 4-(4-bromophenyl)-7-fluoro-3-iodo-2-phenylpyrido[2,3-b]indole-9-carboxylate (PubChem CID 135060193) has the molecular formula C26H17BrFIN2O2 and a molecular weight of 615.24 g/mol. Its IUPAC name is ethyl 4-(4-bromophenyl)-7-fluoro-3-iodo-2-phenylpyrido[2,3-b]indole-9-carboxylate.
| Compound Name | ethyl 4-(4-bromophenyl)-7-fluoro-3-iodo-2-phenylpyrido[2,3-b]indole-9-carboxylate |
|---|---|
| PubChem CID | 135060193 |
| Molecular Formula | C26H17BrFIN2O2 |
| Molecular Weight | 615.24 g/mol |
| Exact Mass | 613.95 |
| IUPAC Name | ethyl 4-(4-bromophenyl)-7-fluoro-3-iodo-2-phenylpyrido[2,3-b]indole-9-carboxylate |
| SMILES | CCOC(=O)n1c2cc(F)ccc2c2c(-c3ccc(Br)cc3)c(I)c(-c3ccccc3)nc21 |
| InChI | InChI=1S/C26H17BrFIN2O2/c1-2-33-26(32)31-20-14-18(28)12-13-19(20)22-21(15-8-10-17(27)11-9-15)23(29)24(30-25(22)31)16-6-4-3-5-7-16/h3-14H,2H2,1H3 |
| InChIKey | GVGOGTHSEFCPLV-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.24 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|