C20H21BrO3 — CID 46868015
(1S)-2-bromo-1-[(3S,4S)-7-methoxy-4-[(E)-2-phenylethenyl]-3,4-dihydro-1H-isochromen-3-yl]ethanol (PubChem CID 46868015) has the molecular formula C20H21BrO3 and a molecular weight of 389.29 g/mol. Its IUPAC name is (1S)-2-bromo-1-[(3S,4S)-7-methoxy-4-[(E)-2-phenylethenyl]-3,4-dihydro-1H-isochromen-3-yl]ethanol.
| Compound Name | (1S)-2-bromo-1-[(3S,4S)-7-methoxy-4-[(E)-2-phenylethenyl]-3,4-dihydro-1H-isochromen-3-yl]ethanol |
|---|---|
| PubChem CID | 46868015 |
| Molecular Formula | C20H21BrO3 |
| Molecular Weight | 389.29 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | (1S)-2-bromo-1-[(3S,4S)-7-methoxy-4-[(E)-2-phenylethenyl]-3,4-dihydro-1H-isochromen-3-yl]ethanol |
| SMILES | COc1ccc2c(c1)CO[C@H]([C@H](O)CBr)[C@H]2/C=C/c1ccccc1 |
| InChI | InChI=1S/C20H21BrO3/c1-23-16-8-10-17-15(11-16)13-24-20(19(22)12-21)18(17)9-7-14-5-3-2-4-6-14/h2-11,18-20,22H,12-13H2,1H3/b9-7+/t18-,19+,20-/m0/s1 |
| InChIKey | SIKOLFFCGGPYCK-DFEBOOOMSA-N |
| XLogP | 4.15 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.29 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|