C22H25FN4O — CID 46879463
1-(cyclohexylmethyl)-2-[(2-fluorophenyl)methylamino]benzimidazole-5-carboxamide (PubChem CID 46879463) has the molecular formula C22H25FN4O and a molecular weight of 380.47 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)-2-[(2-fluorophenyl)methylamino]benzimidazole-5-carboxamide.
| Compound Name | 1-(cyclohexylmethyl)-2-[(2-fluorophenyl)methylamino]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 46879463 |
| Molecular Formula | C22H25FN4O |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 1-(cyclohexylmethyl)-2-[(2-fluorophenyl)methylamino]benzimidazole-5-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)nc(NCc1ccccc1F)n2CC1CCCCC1 |
| InChI | InChI=1S/C22H25FN4O/c23-18-9-5-4-8-17(18)13-25-22-26-19-12-16(21(24)28)10-11-20(19)27(22)14-15-6-2-1-3-7-15/h4-5,8-12,15H,1-3,6-7,13-14H2,(H2,24,28)(H,25,26) |
| InChIKey | YKTSIZVEIVPRIS-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |