C20H23N5O2 — CID 46881798
N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]-2-pyrazol-1-ylacetamide (PubChem CID 46881798) has the molecular formula C20H23N5O2 and a molecular weight of 365.44 g/mol. Its IUPAC name is N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]-2-pyrazol-1-ylacetamide.
| Compound Name | N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]-2-pyrazol-1-ylacetamide |
|---|---|
| PubChem CID | 46881798 |
| Molecular Formula | C20H23N5O2 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]-2-pyrazol-1-ylacetamide |
| SMILES | O=C(Cn1cccn1)Nc1ccc(CCNC[C@H](O)c2cccnc2)cc1 |
| InChI | InChI=1S/C20H23N5O2/c26-19(17-3-1-9-21-13-17)14-22-11-8-16-4-6-18(7-5-16)24-20(27)15-25-12-2-10-23-25/h1-7,9-10,12-13,19,22,26H,8,11,14-15H2,(H,24,27)/t19-/m0/s1 |
| InChIKey | TVBXJWFTWKKHCT-IBGZPJMESA-N |
| XLogP | 1.78 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|