C22H27N5O2 — CID 46881838
2-(3,5-dimethylpyrazol-1-yl)-N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]acetamide (PubChem CID 46881838) has the molecular formula C22H27N5O2 and a molecular weight of 393.49 g/mol. Its IUPAC name is 2-(3,5-dimethylpyrazol-1-yl)-N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]acetamide.
| Compound Name | 2-(3,5-dimethylpyrazol-1-yl)-N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 46881838 |
| Molecular Formula | C22H27N5O2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | 2-(3,5-dimethylpyrazol-1-yl)-N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]acetamide |
| SMILES | Cc1cc(C)n(CC(=O)Nc2ccc(CCNC[C@H](O)c3cccnc3)cc2)n1 |
| InChI | InChI=1S/C22H27N5O2/c1-16-12-17(2)27(26-16)15-22(29)25-20-7-5-18(6-8-20)9-11-24-14-21(28)19-4-3-10-23-13-19/h3-8,10,12-13,21,24,28H,9,11,14-15H2,1-2H3,(H,25,29)/t21-/m0/s1 |
| InChIKey | LRHFSLJAFVMTKO-NRFANRHFSA-N |
| XLogP | 2.40 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|