C32H31N5O2 — CID 46881839
2-(3,5-diphenylpyrazol-1-yl)-N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]acetamide (PubChem CID 46881839) has the molecular formula C32H31N5O2 and a molecular weight of 517.63 g/mol. Its IUPAC name is 2-(3,5-diphenylpyrazol-1-yl)-N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]acetamide.
| Compound Name | 2-(3,5-diphenylpyrazol-1-yl)-N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 46881839 |
| Molecular Formula | C32H31N5O2 |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.25 |
| IUPAC Name | 2-(3,5-diphenylpyrazol-1-yl)-N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]acetamide |
| SMILES | O=C(Cn1nc(-c2ccccc2)cc1-c1ccccc1)Nc1ccc(CCNC[C@H](O)c2cccnc2)cc1 |
| InChI | InChI=1S/C32H31N5O2/c38-31(27-12-7-18-33-21-27)22-34-19-17-24-13-15-28(16-14-24)35-32(39)23-37-30(26-10-5-2-6-11-26)20-29(36-37)25-8-3-1-4-9-25/h1-16,18,20-21,31,34,38H,17,19,22-23H2,(H,35,39)/t31-/m0/s1 |
| InChIKey | NDZNROZJBIXEDW-HKBQPEDESA-N |
| XLogP | 5.12 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|