C23H21NO7S — CID 4688382
[2-(2-nitrophenyl)sulfanyl-3-oxocyclohexen-1-yl] 3-(3,4-dimethoxyphenyl)prop-2-enoate (PubChem CID 4688382) has the molecular formula C23H21NO7S and a molecular weight of 455.49 g/mol. Its IUPAC name is [2-(2-nitrophenyl)sulfanyl-3-oxocyclohexen-1-yl] 3-(3,4-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [2-(2-nitrophenyl)sulfanyl-3-oxocyclohexen-1-yl] 3-(3,4-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 4688382 |
| Molecular Formula | C23H21NO7S |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | [2-(2-nitrophenyl)sulfanyl-3-oxocyclohexen-1-yl] 3-(3,4-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(C=CC(=O)OC2=C(Sc3ccccc3[N+](=O)[O-])C(=O)CCC2)cc1OC |
| InChI | InChI=1S/C23H21NO7S/c1-29-18-12-10-15(14-20(18)30-2)11-13-22(26)31-19-8-5-7-17(25)23(19)32-21-9-4-3-6-16(21)24(27)28/h3-4,6,9-14H,5,7-8H2,1-2H3 |
| InChIKey | WIZBDNRZMVYYJH-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|