C19H16BF2I3N2 — CID 46884131
2,2-difluoro-5,11-diiodo-8-(4-iodophenyl)-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 46884131) has the molecular formula C19H16BF2I3N2 and a molecular weight of 701.87 g/mol. Its IUPAC name is 2,2-difluoro-5,11-diiodo-8-(4-iodophenyl)-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 2,2-difluoro-5,11-diiodo-8-(4-iodophenyl)-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 46884131 |
| Molecular Formula | C19H16BF2I3N2 |
| Molecular Weight | 701.87 g/mol |
| Exact Mass | 701.85 |
| IUPAC Name | 2,2-difluoro-5,11-diiodo-8-(4-iodophenyl)-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | CC1=C(I)C(C)=[N+]2C1=C(c1ccc(I)cc1)c1c(C)c(I)c(C)n1[B-]2(F)F |
| InChI | InChI=1S/C19H16BF2I3N2/c1-9-16(24)11(3)26-18(9)15(13-5-7-14(23)8-6-13)19-10(2)17(25)12(4)27(19)20(26,21)22/h5-8H,1-4H3 |
| InChIKey | KMSLZMUGKMEHHI-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 7.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.87 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|