C19H15BCl2F2I2N2 — CID 71724356
8-(2,6-dichlorophenyl)-2,2-difluoro-5,11-diiodo-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 71724356) has the molecular formula C19H15BCl2F2I2N2 and a molecular weight of 644.87 g/mol. Its IUPAC name is 8-(2,6-dichlorophenyl)-2,2-difluoro-5,11-diiodo-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 8-(2,6-dichlorophenyl)-2,2-difluoro-5,11-diiodo-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 71724356 |
| Molecular Formula | C19H15BCl2F2I2N2 |
| Molecular Weight | 644.87 g/mol |
| Exact Mass | 643.88 |
| IUPAC Name | 8-(2,6-dichlorophenyl)-2,2-difluoro-5,11-diiodo-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | CC1=C(I)C(C)=[N+]2C1=C(c1c(Cl)cccc1Cl)c1c(C)c(I)c(C)n1[B-]2(F)F |
| InChI | InChI=1S/C19H15BCl2F2I2N2/c1-8-16(25)10(3)27-18(8)15(14-12(21)6-5-7-13(14)22)19-9(2)17(26)11(4)28(19)20(27,23)24/h5-7H,1-4H3 |
| InChIKey | WTSNZOXGWAJOMT-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 7.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.87 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|