C16H7BCl6F2N2 — CID 71485775
4,5,6,10,11,12-hexachloro-2,2-difluoro-8-(4-methylphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 71485775) has the molecular formula C16H7BCl6F2N2 and a molecular weight of 488.77 g/mol. Its IUPAC name is 4,5,6,10,11,12-hexachloro-2,2-difluoro-8-(4-methylphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 4,5,6,10,11,12-hexachloro-2,2-difluoro-8-(4-methylphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 71485775 |
| Molecular Formula | C16H7BCl6F2N2 |
| Molecular Weight | 488.77 g/mol |
| Exact Mass | 485.88 |
| IUPAC Name | 4,5,6,10,11,12-hexachloro-2,2-difluoro-8-(4-methylphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | Cc1ccc(C2=C3C(Cl)=C(Cl)C(Cl)=[N+]3[B-](F)(F)n3c(Cl)c(Cl)c(Cl)c32)cc1 |
| InChI | InChI=1S/C16H7BCl6F2N2/c1-6-2-4-7(5-3-6)8-13-9(18)11(20)15(22)26(13)17(24,25)27-14(8)10(19)12(21)16(27)23/h2-5H,1H3 |
| InChIKey | GIOFBWVTWBVAKE-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 7.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.77 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|