C27H15BCl4F2N2 — CID 139192679
4,5,11,12-tetrachloro-2,2-difluoro-6,8,10-triphenyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 139192679) has the molecular formula C27H15BCl4F2N2 and a molecular weight of 558.05 g/mol. Its IUPAC name is 4,5,11,12-tetrachloro-2,2-difluoro-6,8,10-triphenyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 4,5,11,12-tetrachloro-2,2-difluoro-6,8,10-triphenyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 139192679 |
| Molecular Formula | C27H15BCl4F2N2 |
| Molecular Weight | 558.05 g/mol |
| Exact Mass | 556.01 |
| IUPAC Name | 4,5,11,12-tetrachloro-2,2-difluoro-6,8,10-triphenyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | F[B-]1(F)n2c(Cl)c(Cl)c(-c3ccccc3)c2C(c2ccccc2)=C2C(c3ccccc3)=C(Cl)C(Cl)=[N+]21 |
| InChI | InChI=1S/C27H15BCl4F2N2/c29-22-19(16-10-4-1-5-11-16)24-21(18-14-8-3-9-15-18)25-20(17-12-6-2-7-13-17)23(30)27(32)36(25)28(33,34)35(24)26(22)31/h1-15H |
| InChIKey | PNBIUWULPJTZFX-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 7.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.05 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|