C16H10BCl3F2N2 — CID 71485773
4,11,12-trichloro-2,2-difluoro-8-(4-methylphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 71485773) has the molecular formula C16H10BCl3F2N2 and a molecular weight of 385.44 g/mol. Its IUPAC name is 4,11,12-trichloro-2,2-difluoro-8-(4-methylphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 4,11,12-trichloro-2,2-difluoro-8-(4-methylphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 71485773 |
| Molecular Formula | C16H10BCl3F2N2 |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 384.00 |
| IUPAC Name | 4,11,12-trichloro-2,2-difluoro-8-(4-methylphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | Cc1ccc(C2=C3C=C(Cl)C(Cl)=[N+]3[B-](F)(F)n3c(Cl)ccc32)cc1 |
| InChI | InChI=1S/C16H10BCl3F2N2/c1-9-2-4-10(5-3-9)15-12-6-7-14(19)23(12)17(21,22)24-13(15)8-11(18)16(24)20/h2-8H,1H3 |
| InChIKey | HHZCTRDMNSFKIV-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 7.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|