C16H9BCl4F2N2 — CID 71485774
4,5,11,12-tetrachloro-2,2-difluoro-8-(4-methylphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 71485774) has the molecular formula C16H9BCl4F2N2 and a molecular weight of 419.88 g/mol. Its IUPAC name is 4,5,11,12-tetrachloro-2,2-difluoro-8-(4-methylphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 4,5,11,12-tetrachloro-2,2-difluoro-8-(4-methylphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 71485774 |
| Molecular Formula | C16H9BCl4F2N2 |
| Molecular Weight | 419.88 g/mol |
| Exact Mass | 417.96 |
| IUPAC Name | 4,5,11,12-tetrachloro-2,2-difluoro-8-(4-methylphenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | Cc1ccc(C2=C3C=C(Cl)C(Cl)=[N+]3[B-](F)(F)n3c2cc(Cl)c3Cl)cc1 |
| InChI | InChI=1S/C16H9BCl4F2N2/c1-8-2-4-9(5-3-8)14-12-6-10(18)15(20)24(12)17(22,23)25-13(14)7-11(19)16(25)21/h2-7H,1H3 |
| InChIKey | POWAFDJWGATUBY-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 7.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.88 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|