C13H14BClF2N2 — CID 149329773
8-chloro-2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 149329773) has the molecular formula C13H14BClF2N2 and a molecular weight of 282.53 g/mol. Its IUPAC name is 8-chloro-2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 8-chloro-2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 149329773 |
| Molecular Formula | C13H14BClF2N2 |
| Molecular Weight | 282.53 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 8-chloro-2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | CC1=CC(C)=[N+]2C1=C(Cl)c1c(C)cc(C)n1[B-]2(F)F |
| InChI | InChI=1S/C13H14BClF2N2/c1-7-5-9(3)18-12(7)11(15)13-8(2)6-10(4)19(13)14(18,16)17/h5-6H,1-4H3 |
| InChIKey | XEOSWGLGYOHLSC-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 7.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.53 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|