C21H28N2O13S2 — CID 46884215
methyl (2S,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-(4-sulfamoylphenyl)ethylsulfamoyl]oxane-2-carboxylate (PubChem CID 46884215) has the molecular formula C21H28N2O13S2 and a molecular weight of 580.59 g/mol. Its IUPAC name is methyl (2S,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-(4-sulfamoylphenyl)ethylsulfamoyl]oxane-2-carboxylate.
| Compound Name | methyl (2S,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-(4-sulfamoylphenyl)ethylsulfamoyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 46884215 |
| Molecular Formula | C21H28N2O13S2 |
| Molecular Weight | 580.59 g/mol |
| Exact Mass | 580.10 |
| IUPAC Name | methyl (2S,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-(4-sulfamoylphenyl)ethylsulfamoyl]oxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](S(=O)(=O)NCCc2ccc(S(N)(=O)=O)cc2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C21H28N2O13S2/c1-11(24)33-16-17(34-12(2)25)19(35-13(3)26)21(36-18(16)20(27)32-4)38(30,31)23-10-9-14-5-7-15(8-6-14)37(22,28)29/h5-8,16-19,21,23H,9-10H2,1-4H3,(H2,22,28,29)/t16-,17+,18+,19-,21+/m1/s1 |
| InChIKey | SBWLVGFDJPYPAL-CWVBCOCOSA-N |
| XLogP | -1.51 |
| TPSA | 220.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.59 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|