C23H24F3NO4 — CID 46884701
benzyl 1-acetyl-2-[[4-methoxy-3-(trifluoromethyl)phenyl]methyl]pyrrolidine-2-carboxylate (PubChem CID 46884701) has the molecular formula C23H24F3NO4 and a molecular weight of 435.44 g/mol. Its IUPAC name is benzyl 1-acetyl-2-[[4-methoxy-3-(trifluoromethyl)phenyl]methyl]pyrrolidine-2-carboxylate.
| Compound Name | benzyl 1-acetyl-2-[[4-methoxy-3-(trifluoromethyl)phenyl]methyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 46884701 |
| Molecular Formula | C23H24F3NO4 |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | benzyl 1-acetyl-2-[[4-methoxy-3-(trifluoromethyl)phenyl]methyl]pyrrolidine-2-carboxylate |
| SMILES | COc1ccc(CC2(C(=O)OCc3ccccc3)CCCN2C(C)=O)cc1C(F)(F)F |
| InChI | InChI=1S/C23H24F3NO4/c1-16(28)27-12-6-11-22(27,21(29)31-15-17-7-4-3-5-8-17)14-18-9-10-20(30-2)19(13-18)23(24,25)26/h3-5,7-10,13H,6,11-12,14-15H2,1-2H3 |
| InChIKey | RTVTVBAMFSTSSP-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |