C16H21N7O2 — CID 46885550
N-[5-(dimethylamino)-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-yl]hexanamide (PubChem CID 46885550) has the molecular formula C16H21N7O2 and a molecular weight of 343.39 g/mol. Its IUPAC name is N-[5-(dimethylamino)-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-yl]hexanamide.
| Compound Name | N-[5-(dimethylamino)-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-yl]hexanamide |
|---|---|
| PubChem CID | 46885550 |
| Molecular Formula | C16H21N7O2 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | N-[5-(dimethylamino)-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-yl]hexanamide |
| SMILES | CCCCCC(=O)Nc1nc(N(C)C)nc2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C16H21N7O2/c1-4-5-6-9-12(24)17-15-19-14(22(2)3)20-16-18-13(21-23(15)16)11-8-7-10-25-11/h7-8,10H,4-6,9H2,1-3H3,(H,17,18,19,20,21,24) |
| InChIKey | MXGNPZRQEUOQFW-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|