C18H12F4N4O3S2 — CID 46888057
N-(pyridin-2-ylmethyl)-5-sulfamoyl-2-(2,3,5,6-tetrafluorophenyl)sulfanylpyridine-3-carboxamide (PubChem CID 46888057) has the molecular formula C18H12F4N4O3S2 and a molecular weight of 472.45 g/mol. Its IUPAC name is N-(pyridin-2-ylmethyl)-5-sulfamoyl-2-(2,3,5,6-tetrafluorophenyl)sulfanylpyridine-3-carboxamide.
| Compound Name | N-(pyridin-2-ylmethyl)-5-sulfamoyl-2-(2,3,5,6-tetrafluorophenyl)sulfanylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 46888057 |
| Molecular Formula | C18H12F4N4O3S2 |
| Molecular Weight | 472.45 g/mol |
| Exact Mass | 472.03 |
| IUPAC Name | N-(pyridin-2-ylmethyl)-5-sulfamoyl-2-(2,3,5,6-tetrafluorophenyl)sulfanylpyridine-3-carboxamide |
| SMILES | NS(=O)(=O)c1cnc(Sc2c(F)c(F)cc(F)c2F)c(C(=O)NCc2ccccn2)c1 |
| InChI | InChI=1S/C18H12F4N4O3S2/c19-12-6-13(20)15(22)16(14(12)21)30-18-11(5-10(8-26-18)31(23,28)29)17(27)25-7-9-3-1-2-4-24-9/h1-6,8H,7H2,(H,25,27)(H2,23,28,29) |
| InChIKey | UCCQGLWDGDGAGF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.45 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|