C27H36N2O8 — CID 46890458
[(4R,4aS,7aR,12bS)-3-(cyclopropylmethyl)-4a-hydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] N-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]carbamate (PubChem CID 46890458) has the molecular formula C27H36N2O8 and a molecular weight of 516.59 g/mol. Its IUPAC name is [(4R,4aS,7aR,12bS)-3-(cyclopropylmethyl)-4a-hydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] N-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]carbamate.
| Compound Name | [(4R,4aS,7aR,12bS)-3-(cyclopropylmethyl)-4a-hydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] N-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 46890458 |
| Molecular Formula | C27H36N2O8 |
| Molecular Weight | 516.59 g/mol |
| Exact Mass | 516.25 |
| IUPAC Name | [(4R,4aS,7aR,12bS)-3-(cyclopropylmethyl)-4a-hydroxy-7-oxo-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl] N-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]carbamate |
| SMILES | O=C(NCCOCCOCCO)Oc1ccc2c3c1O[C@H]1C(=O)CC[C@@]4(O)[C@@H](C2)N(CC2CC2)CC[C@]314 |
| InChI | InChI=1S/C27H36N2O8/c30-10-12-35-14-13-34-11-8-28-25(32)36-20-4-3-18-15-21-27(33)6-5-19(31)24-26(27,22(18)23(20)37-24)7-9-29(21)16-17-1-2-17/h3-4,17,21,24,30,33H,1-2,5-16H2,(H,28,32)/t21-,24+,26+,27-/m1/s1 |
| InChIKey | KPGXFXMFAOPQEN-JXHGYLODSA-N |
| XLogP | 0.93 |
| TPSA | 126.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.59 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|