C17H34O3Si2 — CID 46894444
[(1E)-1-ethoxy-5-methyl-2-(1-trimethylsilyloxyethenyl)hexa-1,4-dienoxy]-trimethylsilane (PubChem CID 46894444) has the molecular formula C17H34O3Si2 and a molecular weight of 342.63 g/mol. Its IUPAC name is [(1E)-1-ethoxy-5-methyl-2-(1-trimethylsilyloxyethenyl)hexa-1,4-dienoxy]-trimethylsilane.
| Compound Name | [(1E)-1-ethoxy-5-methyl-2-(1-trimethylsilyloxyethenyl)hexa-1,4-dienoxy]-trimethylsilane |
|---|---|
| PubChem CID | 46894444 |
| Molecular Formula | C17H34O3Si2 |
| Molecular Weight | 342.63 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | [(1E)-1-ethoxy-5-methyl-2-(1-trimethylsilyloxyethenyl)hexa-1,4-dienoxy]-trimethylsilane |
| SMILES | C=C(O[Si](C)(C)C)/C(CC=C(C)C)=C(\OCC)O[Si](C)(C)C |
| InChI | InChI=1S/C17H34O3Si2/c1-11-18-17(20-22(8,9)10)16(13-12-14(2)3)15(4)19-21(5,6)7/h12H,4,11,13H2,1-3,5-10H3/b17-16+ |
| InChIKey | NBXUVFJELQJZNO-WUKNDPDISA-N |
| XLogP | 5.81 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.63 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|