C15H26O3 — CID 46895205
1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5,6-dimethyl-3-methylidenehept-5-en-1-ol (PubChem CID 46895205) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is 1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5,6-dimethyl-3-methylidenehept-5-en-1-ol.
| Compound Name | 1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5,6-dimethyl-3-methylidenehept-5-en-1-ol |
|---|---|
| PubChem CID | 46895205 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | 1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-5,6-dimethyl-3-methylidenehept-5-en-1-ol |
| SMILES | C=C(CC(C)=C(C)C)CC(O)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C15H26O3/c1-10(2)12(4)7-11(3)8-13(16)14-9-17-15(5,6)18-14/h13-14,16H,3,7-9H2,1-2,4-6H3/t13?,14-/m1/s1 |
| InChIKey | OJEOOJJPJQUZHX-ARLHGKGLSA-N |
| XLogP | 3.19 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|