C14H24O4 — CID 134967770
(E,3S)-8-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methylideneoct-6-ene-1,3-diol (PubChem CID 134967770) has the molecular formula C14H24O4 and a molecular weight of 256.34 g/mol. Its IUPAC name is (E,3S)-8-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methylideneoct-6-ene-1,3-diol.
| Compound Name | (E,3S)-8-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methylideneoct-6-ene-1,3-diol |
|---|---|
| PubChem CID | 134967770 |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | (E,3S)-8-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methylideneoct-6-ene-1,3-diol |
| SMILES | C=C(C/C=C/C[C@H]1COC(C)(C)O1)[C@@H](O)CCO |
| InChI | InChI=1S/C14H24O4/c1-11(13(16)8-9-15)6-4-5-7-12-10-17-14(2,3)18-12/h4-5,12-13,15-16H,1,6-10H2,2-3H3/b5-4+/t12-,13-/m0/s1 |
| InChIKey | YXNGQTIJDWSMFT-WWKJKZQJSA-N |
| XLogP | 1.77 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|