C31H64O4Si3 — CID 46895828
(5S,6S,7R,8S,9S)-6,8,10-tris[[tert-butyl(dimethyl)silyl]oxy]-5,7,9-trimethyldec-1-yn-3-one (PubChem CID 46895828) has the molecular formula C31H64O4Si3 and a molecular weight of 585.11 g/mol. Its IUPAC name is (5S,6S,7R,8S,9S)-6,8,10-tris[[tert-butyl(dimethyl)silyl]oxy]-5,7,9-trimethyldec-1-yn-3-one.
| Compound Name | (5S,6S,7R,8S,9S)-6,8,10-tris[[tert-butyl(dimethyl)silyl]oxy]-5,7,9-trimethyldec-1-yn-3-one |
|---|---|
| PubChem CID | 46895828 |
| Molecular Formula | C31H64O4Si3 |
| Molecular Weight | 585.11 g/mol |
| Exact Mass | 584.41 |
| IUPAC Name | (5S,6S,7R,8S,9S)-6,8,10-tris[[tert-butyl(dimethyl)silyl]oxy]-5,7,9-trimethyldec-1-yn-3-one |
| SMILES | C#CC(=O)C[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H64O4Si3/c1-20-26(32)21-23(2)27(34-37(16,17)30(8,9)10)25(4)28(35-38(18,19)31(11,12)13)24(3)22-33-36(14,15)29(5,6)7/h1,23-25,27-28H,21-22H2,2-19H3/t23-,24-,25+,27-,28-/m0/s1 |
| InChIKey | QDDYRVJXRVLCCV-WHOBFWAKSA-N |
| XLogP | 9.29 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.11 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|