C17H16ClN5 — CID 46899551
3-(2-chloro-4-pyridinyl)-1-piperazin-1-yl-2,6-naphthyridine (PubChem CID 46899551) has the molecular formula C17H16ClN5 and a molecular weight of 325.80 g/mol. Its IUPAC name is 3-(2-chloro-4-pyridinyl)-1-piperazin-1-yl-2,6-naphthyridine.
| Compound Name | 3-(2-chloro-4-pyridinyl)-1-piperazin-1-yl-2,6-naphthyridine |
|---|---|
| PubChem CID | 46899551 |
| Molecular Formula | C17H16ClN5 |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 3-(2-chloro-4-pyridinyl)-1-piperazin-1-yl-2,6-naphthyridine |
| SMILES | Clc1cc(-c2cc3cnccc3c(N3CCNCC3)n2)ccn1 |
| InChI | InChI=1S/C17H16ClN5/c18-16-10-12(1-4-21-16)15-9-13-11-20-3-2-14(13)17(22-15)23-7-5-19-6-8-23/h1-4,9-11,19H,5-8H2 |
| InChIKey | GAEKZIARZJRZTM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|