C29H50O6SSi2 — CID 46901480
[(4S,5R)-4-[[2-(benzenesulfonyl)-3-prop-2-enyloxiran-2-yl]methyl]-2,2-ditert-butyl-1,3,2-dioxasilinan-5-yl]oxy-triethylsilane (PubChem CID 46901480) has the molecular formula C29H50O6SSi2 and a molecular weight of 582.95 g/mol. Its IUPAC name is [(4S,5R)-4-[[2-(benzenesulfonyl)-3-prop-2-enyloxiran-2-yl]methyl]-2,2-ditert-butyl-1,3,2-dioxasilinan-5-yl]oxy-triethylsilane.
| Compound Name | [(4S,5R)-4-[[2-(benzenesulfonyl)-3-prop-2-enyloxiran-2-yl]methyl]-2,2-ditert-butyl-1,3,2-dioxasilinan-5-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 46901480 |
| Molecular Formula | C29H50O6SSi2 |
| Molecular Weight | 582.95 g/mol |
| Exact Mass | 582.29 |
| IUPAC Name | [(4S,5R)-4-[[2-(benzenesulfonyl)-3-prop-2-enyloxiran-2-yl]methyl]-2,2-ditert-butyl-1,3,2-dioxasilinan-5-yl]oxy-triethylsilane |
| SMILES | C=CCC1OC1(C[C@@H]1O[Si](C(C)(C)C)(C(C)(C)C)OC[C@H]1O[Si](CC)(CC)CC)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C29H50O6SSi2/c1-11-18-26-29(33-26,36(30,31)23-19-16-15-17-20-23)21-24-25(34-37(12-2,13-3)14-4)22-32-38(35-24,27(5,6)7)28(8,9)10/h11,15-17,19-20,24-26H,1,12-14,18,21-22H2,2-10H3/t24-,25+,26?,29?/m0/s1 |
| InChIKey | OQRFYVLCJOZYAJ-LVCOASFDSA-N |
| XLogP | 7.37 |
| TPSA | 74.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.95 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|