C25H41NO4 — CID 46907092
N-[(5R)-5-[(1R,3aS,4E,7aR)-4-[2-[(3R,5R)-3,5-dihydroxycyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]hexyl]-N-hydroxyformamide (PubChem CID 46907092) has the molecular formula C25H41NO4 and a molecular weight of 419.61 g/mol. Its IUPAC name is N-[(5R)-5-[(1R,3aS,4E,7aR)-4-[2-[(3R,5R)-3,5-dihydroxycyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]hexyl]-N-hydroxyformamide.
| Compound Name | N-[(5R)-5-[(1R,3aS,4E,7aR)-4-[2-[(3R,5R)-3,5-dihydroxycyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]hexyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 46907092 |
| Molecular Formula | C25H41NO4 |
| Molecular Weight | 419.61 g/mol |
| Exact Mass | 419.30 |
| IUPAC Name | N-[(5R)-5-[(1R,3aS,4E,7aR)-4-[2-[(3R,5R)-3,5-dihydroxycyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]hexyl]-N-hydroxyformamide |
| SMILES | C[C@H](CCCCN(O)C=O)[C@H]1CC[C@H]2/C(=C/C=C3C[C@@H](O)C[C@H](O)C3)CCC[C@]12C |
| InChI | InChI=1S/C25H41NO4/c1-18(6-3-4-13-26(30)17-27)23-10-11-24-20(7-5-12-25(23,24)2)9-8-19-14-21(28)16-22(29)15-19/h8-9,17-18,21-24,28-30H,3-7,10-16H2,1-2H3/b20-9+/t18-,21-,22-,23-,24+,25-/m1/s1 |
| InChIKey | JXVNUNRGEFBJOP-WOOVRTBCSA-N |
| XLogP | 4.62 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.61 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|